4-cyclohexyloxybenzoic acid

4-cyclohexyloxybenzoic acid - Names and Identifiers

Name	4-cyclohexyloxybenzoic acid
Synonyms	AKOS BC-1915 4-Cyclohexyloxybenzoic acid 4-cyclohexyloxybenzoic acid P-CYCLOHEXYLOXYBENZOIC ACID PARA-(CYCLOHEXYLOXY)BENZOICACID Benzoic acid, 4-(cyclohexyloxy)-
CAS	139-61-7
EINECS	205-369-3
InChI	InChI=1/C13H16O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H,14,15)

4-cyclohexyloxybenzoic acid - Physico-chemical Properties

Molecular Formula	C13H16O3
Molar Mass	220.26
Density	1.168g/cm³
Boling Point	368.4°C at 760 mmHg
Flash Point	140°C
Vapor Presure	4.47E-06mmHg at 25°C
Storage Condition	2-8°C
Refractive Index	1.559

4-cyclohexyloxybenzoic acid - Introduction

4-cyclohexyloxybenzoic acid (acid) is an organic compound with the chemical formula C13H16O3.

Nature:
-Appearance: Colorless or light yellow solid
-Solubility: It can be dissolved in non-polar solvents, such as ether, chloroform and benzene, but it has poor solubility in water.
-Melting point: about 110-112°C

Use:
-4-cyclohexyloxybenzoic acid can be used in the preparation of liquid crystal materials, especially liquid crystals in liquid crystal displays (LCD).
-It can also be used as a synthetic intermediate for polymer compounds, such as polyester and polyamide.

Preparation Method:
4-Cyclohexyloxybenzoic acid is generally synthesized by the following steps:
1. cyclohexanone and bromobenzene reaction, generate organic bromide.
2. the organic bromide and sodium phenyl formate reaction, the formation of esterification products.
3. finally through the hydrolysis of esterification products, generation of 4-cyclohexyl benzoic acid.

Safety Information:
-4-Cyclohexoxybenzoic acid has no specific risk, but it still needs to follow the routine laboratory safety operation.
-Avoid skin and eye contact when touching.
-During use, provide good ventilation and use appropriate personal protective equipment, such as gloves, glasses and lab clothes.
-If necessary, please refer to the safety technical manual of the compound for more detailed safety information.

Last Update：2024-04-10 22:29:15